C25H27N7O6S3 — CID 54376110
tert-butyl (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-[(4-oxo-1H-2,1,3-benzothiadiazin-3-yl)methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 54376110) has the molecular formula C25H27N7O6S3 and a molecular weight of 617.74 g/mol. Its IUPAC name is tert-butyl (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-[(4-oxo-1H-2,1,3-benzothiadiazin-3-yl)methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | tert-butyl (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-[(4-oxo-1H-2,1,3-benzothiadiazin-3-yl)methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 54376110 |
| Molecular Formula | C25H27N7O6S3 |
| Molecular Weight | 617.74 g/mol |
| Exact Mass | 617.12 |
| IUPAC Name | tert-butyl (6R,7R)-7-[[2-(2-amino-1,3-thiazol-4-yl)-2-methoxyiminoacetyl]amino]-8-oxo-3-[(4-oxo-1H-2,1,3-benzothiadiazin-3-yl)methyl]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CON=C(C(=O)N[C@@H]1C(=O)N2C(C(=O)OC(C)(C)C)=C(CN3SNc4ccccc4C3=O)CS[C@H]12)c1csc(N)n1 |
| InChI | InChI=1S/C25H27N7O6S3/c1-25(2,3)38-23(36)18-12(9-31-20(34)13-7-5-6-8-14(13)30-41-31)10-39-22-17(21(35)32(18)22)28-19(33)16(29-37-4)15-11-40-24(26)27-15/h5-8,11,17,22,30H,9-10H2,1-4H3,(H2,26,27)(H,28,33)/t17-,22-/m1/s1 |
| InChIKey | UWOWUTNIKOXAGS-VGOFRKELSA-N |
| XLogP | 2.20 |
| TPSA | 168.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.74 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|