C24H39F3O5Si — CID 54377328
2-hydroxy-7-[(1R,5R)-2-oxo-5-[4-(trifluoromethyl)-4-trimethylsilyloxyoct-1-enyl]cyclopentyl]hept-5-enoic acid (PubChem CID 54377328) has the molecular formula C24H39F3O5Si and a molecular weight of 492.65 g/mol. Its IUPAC name is 2-hydroxy-7-[(1R,5R)-2-oxo-5-[4-(trifluoromethyl)-4-trimethylsilyloxyoct-1-enyl]cyclopentyl]hept-5-enoic acid.
| Compound Name | 2-hydroxy-7-[(1R,5R)-2-oxo-5-[4-(trifluoromethyl)-4-trimethylsilyloxyoct-1-enyl]cyclopentyl]hept-5-enoic acid |
|---|---|
| PubChem CID | 54377328 |
| Molecular Formula | C24H39F3O5Si |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.25 |
| IUPAC Name | 2-hydroxy-7-[(1R,5R)-2-oxo-5-[4-(trifluoromethyl)-4-trimethylsilyloxyoct-1-enyl]cyclopentyl]hept-5-enoic acid |
| SMILES | CCCCC(CC=C[C@H]1CCC(=O)[C@@H]1CC=CCCC(O)C(=O)O)(O[Si](C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C24H39F3O5Si/c1-5-6-16-23(24(25,26)27,32-33(2,3)4)17-10-11-18-14-15-20(28)19(18)12-8-7-9-13-21(29)22(30)31/h7-8,10-11,18-19,21,29H,5-6,9,12-17H2,1-4H3,(H,30,31)/t18-,19+,21?,23?/m0/s1 |
| InChIKey | UXLLDFWXCRKSPA-BYUXKFDVSA-N |
| XLogP | 6.04 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|