C10H5F2N3O3 — CID 54378488
4,4-difluoro-7-nitroimidazo[2,1-c][1,4]benzoxazine (PubChem CID 54378488) has the molecular formula C10H5F2N3O3 and a molecular weight of 253.16 g/mol. Its IUPAC name is 4,4-difluoro-7-nitroimidazo[2,1-c][1,4]benzoxazine.
| Compound Name | 4,4-difluoro-7-nitroimidazo[2,1-c][1,4]benzoxazine |
|---|---|
| PubChem CID | 54378488 |
| Molecular Formula | C10H5F2N3O3 |
| Molecular Weight | 253.16 g/mol |
| Exact Mass | 253.03 |
| IUPAC Name | 4,4-difluoro-7-nitroimidazo[2,1-c][1,4]benzoxazine |
| SMILES | O=[N+]([O-])c1ccc2c(c1)OC(F)(F)c1nccn1-2 |
| InChI | InChI=1S/C10H5F2N3O3/c11-10(12)9-13-3-4-14(9)7-2-1-6(15(16)17)5-8(7)18-10/h1-5H |
| InChIKey | UYGJHNXSTYHNCH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.16 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|