C19H37N7O3 — CID 54378525
(2S)-N-[(2S)-2-[[(2R)-2-amino-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-1-ethylpyrrolidine-2-carboxamide (PubChem CID 54378525) has the molecular formula C19H37N7O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is (2S)-N-[(2S)-2-[[(2R)-2-amino-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-1-ethylpyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-2-[[(2R)-2-amino-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-1-ethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 54378525 |
| Molecular Formula | C19H37N7O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.30 |
| IUPAC Name | (2S)-N-[(2S)-2-[[(2R)-2-amino-4-methylpentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]-1-ethylpyrrolidine-2-carboxamide |
| SMILES | CCN1CCC[C@H]1C(=O)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](N)CC(C)C |
| InChI | InChI=1S/C19H37N7O3/c1-4-26-10-6-8-15(26)18(29)25-17(28)14(7-5-9-23-19(21)22)24-16(27)13(20)11-12(2)3/h12-15H,4-11,20H2,1-3H3,(H,24,27)(H4,21,22,23)(H,25,28,29)/t13-,14+,15+/m1/s1 |
| InChIKey | UYGWFSPQOCYHQM-ILXRZTDVSA-N |
| XLogP | -0.97 |
| TPSA | 168.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|