C19H37Cl2N7O4 — CID 88604878
(2S)-2-amino-N-[(2S)-1-[(2S)-2-(3-amino-3-oxopropanoyl)pyrrolidin-1-yl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methylpentanamide;dihydrochloride (PubChem CID 88604878) has the molecular formula C19H37Cl2N7O4 and a molecular weight of 498.46 g/mol. Its IUPAC name is (2S)-2-amino-N-[(2S)-1-[(2S)-2-(3-amino-3-oxopropanoyl)pyrrolidin-1-yl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methylpentanamide;dihydrochloride.
| Compound Name | (2S)-2-amino-N-[(2S)-1-[(2S)-2-(3-amino-3-oxopropanoyl)pyrrolidin-1-yl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methylpentanamide;dihydrochloride |
|---|---|
| PubChem CID | 88604878 |
| Molecular Formula | C19H37Cl2N7O4 |
| Molecular Weight | 498.46 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | (2S)-2-amino-N-[(2S)-1-[(2S)-2-(3-amino-3-oxopropanoyl)pyrrolidin-1-yl]-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methylpentanamide;dihydrochloride |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@@H](CCCN=C(N)N)C(=O)N1CCC[C@H]1C(=O)CC(N)=O.Cl.Cl |
| InChI | InChI=1S/C19H35N7O4.2ClH/c1-11(2)9-12(20)17(29)25-13(5-3-7-24-19(22)23)18(30)26-8-4-6-14(26)15(27)10-16(21)28;;/h11-14H,3-10,20H2,1-2H3,(H2,21,28)(H,25,29)(H4,22,23,24);2*1H/t12-,13-,14-;;/m0../s1 |
| InChIKey | WVVUEGOTBRDFAB-PAALKQLMSA-N |
| XLogP | -0.82 |
| TPSA | 199.99 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.46 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|