C16H19N3O3S — CID 54379508
1-[2-amino-4-(benzenesulfinyl)phenyl]-3-(2-methoxyethyl)urea (PubChem CID 54379508) has the molecular formula C16H19N3O3S and a molecular weight of 333.41 g/mol. Its IUPAC name is 1-[2-amino-4-(benzenesulfinyl)phenyl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[2-amino-4-(benzenesulfinyl)phenyl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 54379508 |
| Molecular Formula | C16H19N3O3S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.11 |
| IUPAC Name | 1-[2-amino-4-(benzenesulfinyl)phenyl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)Nc1ccc(S(=O)c2ccccc2)cc1N |
| InChI | InChI=1S/C16H19N3O3S/c1-22-10-9-18-16(20)19-15-8-7-13(11-14(15)17)23(21)12-5-3-2-4-6-12/h2-8,11H,9-10,17H2,1H3,(H2,18,19,20) |
| InChIKey | UYYDHHBBQDLRRF-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|