C18H15ClF2N4O — CID 54380800
3-(4-amino-2-chlorophenyl)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)but-3-en-2-ol (PubChem CID 54380800) has the molecular formula C18H15ClF2N4O and a molecular weight of 376.79 g/mol. Its IUPAC name is 3-(4-amino-2-chlorophenyl)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)but-3-en-2-ol.
| Compound Name | 3-(4-amino-2-chlorophenyl)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)but-3-en-2-ol |
|---|---|
| PubChem CID | 54380800 |
| Molecular Formula | C18H15ClF2N4O |
| Molecular Weight | 376.79 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 3-(4-amino-2-chlorophenyl)-2-(2,4-difluorophenyl)-1-(1,2,4-triazol-1-yl)but-3-en-2-ol |
| SMILES | C=C(c1ccc(N)cc1Cl)C(O)(Cn1cncn1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H15ClF2N4O/c1-11(14-4-3-13(22)7-16(14)19)18(26,8-25-10-23-9-24-25)15-5-2-12(20)6-17(15)21/h2-7,9-10,26H,1,8,22H2 |
| InChIKey | UZTDKFUCLGWEFT-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.79 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|