C12H18O2 — CID 54383049
2,3,5-triethylhexa-2,4-dienedial (PubChem CID 54383049) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 2,3,5-triethylhexa-2,4-dienedial.
| Compound Name | 2,3,5-triethylhexa-2,4-dienedial |
|---|---|
| PubChem CID | 54383049 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2,3,5-triethylhexa-2,4-dienedial |
| SMILES | CCC(C=O)=CC(CC)=C(C=O)CC |
| InChI | InChI=1S/C12H18O2/c1-4-10(8-13)7-11(5-2)12(6-3)9-14/h7-9H,4-6H2,1-3H3 |
| InChIKey | VBHPMFMGLRDXLL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|