C21H36O5 — CID 54384081
[2-(3-ethylhexan-3-yloxy)-2-(2-methylprop-2-enoyloxymethyl)butyl] 2-methylprop-2-enoate (PubChem CID 54384081) has the molecular formula C21H36O5 and a molecular weight of 368.51 g/mol. Its IUPAC name is [2-(3-ethylhexan-3-yloxy)-2-(2-methylprop-2-enoyloxymethyl)butyl] 2-methylprop-2-enoate.
| Compound Name | [2-(3-ethylhexan-3-yloxy)-2-(2-methylprop-2-enoyloxymethyl)butyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54384081 |
| Molecular Formula | C21H36O5 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | [2-(3-ethylhexan-3-yloxy)-2-(2-methylprop-2-enoyloxymethyl)butyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(CC)(COC(=O)C(=C)C)OC(CC)(CC)CCC |
| InChI | InChI=1S/C21H36O5/c1-9-13-20(10-2,11-3)26-21(12-4,14-24-18(22)16(5)6)15-25-19(23)17(7)8/h5,7,9-15H2,1-4,6,8H3 |
| InChIKey | VBZRKWKNYUEEFU-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|