C13H19NO3 — CID 54385143
1-[4-(2,5-dihydroxy-3-methylpyrrol-1-yl)cyclohexyl]ethanone (PubChem CID 54385143) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 1-[4-(2,5-dihydroxy-3-methylpyrrol-1-yl)cyclohexyl]ethanone.
| Compound Name | 1-[4-(2,5-dihydroxy-3-methylpyrrol-1-yl)cyclohexyl]ethanone |
|---|---|
| PubChem CID | 54385143 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 1-[4-(2,5-dihydroxy-3-methylpyrrol-1-yl)cyclohexyl]ethanone |
| SMILES | CC(=O)C1CCC(n2c(O)cc(C)c2O)CC1 |
| InChI | InChI=1S/C13H19NO3/c1-8-7-12(16)14(13(8)17)11-5-3-10(4-6-11)9(2)15/h7,10-11,16-17H,3-6H2,1-2H3 |
| InChIKey | VCRVBNKDQLVHCL-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |