C11H15NO3 — CID 90771562
4-(2,5-dihydroxypyrrol-1-yl)cyclohexane-1-carbaldehyde (PubChem CID 90771562) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 4-(2,5-dihydroxypyrrol-1-yl)cyclohexane-1-carbaldehyde.
| Compound Name | 4-(2,5-dihydroxypyrrol-1-yl)cyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 90771562 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 4-(2,5-dihydroxypyrrol-1-yl)cyclohexane-1-carbaldehyde |
| SMILES | O=CC1CCC(n2c(O)ccc2O)CC1 |
| InChI | InChI=1S/C11H15NO3/c13-7-8-1-3-9(4-2-8)12-10(14)5-6-11(12)15/h5-9,14-15H,1-4H2 |
| InChIKey | JNNMKSMYYNTCAC-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|