C13H19NO3S — CID 123755350
4-[(2,5-dihydroxy-3-methylpyrrol-1-yl)methyl]cyclohexane-1-carbothioic S-acid (PubChem CID 123755350) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 4-[(2,5-dihydroxy-3-methylpyrrol-1-yl)methyl]cyclohexane-1-carbothioic S-acid.
| Compound Name | 4-[(2,5-dihydroxy-3-methylpyrrol-1-yl)methyl]cyclohexane-1-carbothioic S-acid |
|---|---|
| PubChem CID | 123755350 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 4-[(2,5-dihydroxy-3-methylpyrrol-1-yl)methyl]cyclohexane-1-carbothioic S-acid |
| SMILES | Cc1cc(O)n(CC2CCC(C(=O)S)CC2)c1O |
| InChI | InChI=1S/C13H19NO3S/c1-8-6-11(15)14(12(8)16)7-9-2-4-10(5-3-9)13(17)18/h6,9-10,15-16H,2-5,7H2,1H3,(H,17,18) |
| InChIKey | NBVZTXCOHTYACL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|