C11H19NO2 — CID 90777271
1-hexyl-3-methylpyrrole-2,5-diol (PubChem CID 90777271) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is 1-hexyl-3-methylpyrrole-2,5-diol.
| Compound Name | 1-hexyl-3-methylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 90777271 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | 1-hexyl-3-methylpyrrole-2,5-diol |
| SMILES | CCCCCCn1c(O)cc(C)c1O |
| InChI | InChI=1S/C11H19NO2/c1-3-4-5-6-7-12-10(13)8-9(2)11(12)14/h8,13-14H,3-7H2,1-2H3 |
| InChIKey | HCEFGNVOYVNPPC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|