C14H6F17NO2 — CID 123481878
3-ethenyl-1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)pyrrole-2,5-diol (PubChem CID 123481878) has the molecular formula C14H6F17NO2 and a molecular weight of 543.17 g/mol. Its IUPAC name is 3-ethenyl-1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)pyrrole-2,5-diol.
| Compound Name | 3-ethenyl-1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 123481878 |
| Molecular Formula | C14H6F17NO2 |
| Molecular Weight | 543.17 g/mol |
| Exact Mass | 543.01 |
| IUPAC Name | 3-ethenyl-1-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)pyrrole-2,5-diol |
| SMILES | C=Cc1cc(O)n(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1O |
| InChI | InChI=1S/C14H6F17NO2/c1-2-4-3-5(33)32(6(4)34)14(30,31)12(25,26)10(21,22)8(17,18)7(15,16)9(19,20)11(23,24)13(27,28)29/h2-3,33-34H,1H2 |
| InChIKey | LTLBXIMZNZHTBG-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.17 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|