C10H6F9NO2 — CID 123775931
3-ethenyl-1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrrole-2,5-diol (PubChem CID 123775931) has the molecular formula C10H6F9NO2 and a molecular weight of 343.15 g/mol. Its IUPAC name is 3-ethenyl-1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrrole-2,5-diol.
| Compound Name | 3-ethenyl-1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrrole-2,5-diol |
|---|---|
| PubChem CID | 123775931 |
| Molecular Formula | C10H6F9NO2 |
| Molecular Weight | 343.15 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 3-ethenyl-1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyrrole-2,5-diol |
| SMILES | C=Cc1cc(O)n(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1O |
| InChI | InChI=1S/C10H6F9NO2/c1-2-4-3-5(21)20(6(4)22)10(18,19)8(13,14)7(11,12)9(15,16)17/h2-3,21-22H,1H2 |
| InChIKey | NDHUQGATFIXZII-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.15 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|