About 1-(trifluoromethylsulfinyl)pyrrole-2,5-diol
1-(trifluoromethylsulfinyl)pyrrole-2,5-diol (PubChem CID 91418910) has the molecular formula C5H4F3NO3S
and a molecular weight of 215.15 g/mol. Its IUPAC name is 1-(trifluoromethylsulfinyl)pyrrole-2,5-diol.
Molecular Properties
| Compound Name | 1-(trifluoromethylsulfinyl)pyrrole-2,5-diol |
| PubChem CID | 91418910 |
| Molecular Formula | C5H4F3NO3S |
| Molecular Weight | 215.15 g/mol |
| Exact Mass | 214.99 |
| IUPAC Name | 1-(trifluoromethylsulfinyl)pyrrole-2,5-diol |
| SMILES | O=S(n1c(O)ccc1O)C(F)(F)F |
| InChI | InChI=1S/C5H4F3NO3S/c6-5(7,8)13(12)9-3(10)1-2-4(9)11/h1-2,10-11H |
| InChIKey | LPNJFHOEWSQUPV-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 62.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.15 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(trifluoromethylsulfinyl)pyrrole-2,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(trifluoromethylsulfinyl)pyrrole-2,5-diol?
The IUPAC name of 1-(trifluoromethylsulfinyl)pyrrole-2,5-diol (CID 91418910) is 1-(trifluoromethylsulfinyl)pyrrole-2,5-diol.
What is the SMILES notation for 1-(trifluoromethylsulfinyl)pyrrole-2,5-diol?
The canonical SMILES for 1-(trifluoromethylsulfinyl)pyrrole-2,5-diol is O=S(n1c(O)ccc1O)C(F)(F)F.
What is the InChIKey of 1-(trifluoromethylsulfinyl)pyrrole-2,5-diol?
The InChIKey is LPNJFHOEWSQUPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4F3NO3S/c6-5(7,8)13(12)9-3(10)1-2-4(9)11/h1-2,10-11H.
What are the key properties of 1-(trifluoromethylsulfinyl)pyrrole-2,5-diol?
1-(trifluoromethylsulfinyl)pyrrole-2,5-diol has a molecular weight of 215.15 g/mol, XLogP of 0.93, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(trifluoromethylsulfinyl)pyrrole-2,5-diol is sourced from PubChem (CID 91418910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).