C10H13NO2 — CID 90754965
1-methyl-3-penta-1,2-dienylpyrrole-2,5-diol (PubChem CID 90754965) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-methyl-3-penta-1,2-dienylpyrrole-2,5-diol.
| Compound Name | 1-methyl-3-penta-1,2-dienylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 90754965 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-methyl-3-penta-1,2-dienylpyrrole-2,5-diol |
| SMILES | CCC=C=Cc1cc(O)n(C)c1O |
| InChI | InChI=1S/C10H13NO2/c1-3-4-5-6-8-7-9(12)11(2)10(8)13/h4,6-7,12-13H,3H2,1-2H3 |
| InChIKey | KWYWRKXYXGOEPO-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |