C21H39NO2 — CID 91228593
1-hexadecyl-3-methylpyrrole-2,5-diol (PubChem CID 91228593) has the molecular formula C21H39NO2 and a molecular weight of 337.55 g/mol. Its IUPAC name is 1-hexadecyl-3-methylpyrrole-2,5-diol.
| Compound Name | 1-hexadecyl-3-methylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91228593 |
| Molecular Formula | C21H39NO2 |
| Molecular Weight | 337.55 g/mol |
| Exact Mass | 337.30 |
| IUPAC Name | 1-hexadecyl-3-methylpyrrole-2,5-diol |
| SMILES | CCCCCCCCCCCCCCCCn1c(O)cc(C)c1O |
| InChI | InChI=1S/C21H39NO2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-22-20(23)18-19(2)21(22)24/h18,23-24H,3-17H2,1-2H3 |
| InChIKey | NQIHZPJJKIMEMD-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.55 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|