About S-[methyl(propyl)amino] methanethioate
S-[methyl(propyl)amino] methanethioate (PubChem CID 54385630) has the molecular formula C5H11NOS
and a molecular weight of 133.22 g/mol. Its IUPAC name is S-[methyl(propyl)amino] methanethioate.
Molecular Properties
| Compound Name | S-[methyl(propyl)amino] methanethioate |
| PubChem CID | 54385630 |
| Molecular Formula | C5H11NOS |
| Molecular Weight | 133.22 g/mol |
| Exact Mass | 133.06 |
| IUPAC Name | S-[methyl(propyl)amino] methanethioate |
| SMILES | CCCN(C)SC=O |
| InChI | InChI=1S/C5H11NOS/c1-3-4-6(2)8-5-7/h5H,3-4H2,1-2H3 |
| InChIKey | PUKILHWJYNBGMR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.22 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[methyl(propyl)amino] methanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[methyl(propyl)amino] methanethioate?
The IUPAC name of S-[methyl(propyl)amino] methanethioate (CID 54385630) is S-[methyl(propyl)amino] methanethioate.
What is the SMILES notation for S-[methyl(propyl)amino] methanethioate?
The canonical SMILES for S-[methyl(propyl)amino] methanethioate is CCCN(C)SC=O.
What is the InChIKey of S-[methyl(propyl)amino] methanethioate?
The InChIKey is PUKILHWJYNBGMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NOS/c1-3-4-6(2)8-5-7/h5H,3-4H2,1-2H3.
What are the key properties of S-[methyl(propyl)amino] methanethioate?
S-[methyl(propyl)amino] methanethioate has a molecular weight of 133.22 g/mol, XLogP of 1.17, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-[methyl(propyl)amino] methanethioate is sourced from PubChem (CID 54385630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).