About 2-hydroxy-2-phenylpropanebis(thioic S-acid)
2-hydroxy-2-phenylpropanebis(thioic S-acid) (PubChem CID 54385929) has the molecular formula C9H8O3S2
and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-hydroxy-2-phenylpropanebis(thioic S-acid).
Molecular Properties
| Compound Name | 2-hydroxy-2-phenylpropanebis(thioic S-acid) |
| PubChem CID | 54385929 |
| Molecular Formula | C9H8O3S2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 227.99 |
| IUPAC Name | 2-hydroxy-2-phenylpropanebis(thioic S-acid) |
| SMILES | O=C(S)C(O)(C(=O)S)c1ccccc1 |
| InChI | InChI=1S/C9H8O3S2/c10-7(13)9(12,8(11)14)6-4-2-1-3-5-6/h1-5,12H,(H,10,13)(H,11,14) |
| InChIKey | VDFPLOOBUJZSGW-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-phenylpropanebis(thioic S-acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-phenylpropanebis(thioic S-acid)?
The IUPAC name of 2-hydroxy-2-phenylpropanebis(thioic S-acid) (CID 54385929) is 2-hydroxy-2-phenylpropanebis(thioic S-acid).
What is the SMILES notation for 2-hydroxy-2-phenylpropanebis(thioic S-acid)?
The canonical SMILES for 2-hydroxy-2-phenylpropanebis(thioic S-acid) is O=C(S)C(O)(C(=O)S)c1ccccc1.
What is the InChIKey of 2-hydroxy-2-phenylpropanebis(thioic S-acid)?
The InChIKey is VDFPLOOBUJZSGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O3S2/c10-7(13)9(12,8(11)14)6-4-2-1-3-5-6/h1-5,12H,(H,10,13)(H,11,14).
What are the key properties of 2-hydroxy-2-phenylpropanebis(thioic S-acid)?
2-hydroxy-2-phenylpropanebis(thioic S-acid) has a molecular weight of 228.29 g/mol, XLogP of 0.79, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-phenylpropanebis(thioic S-acid) is sourced from PubChem (CID 54385929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).