C25H34N2O — CID 54386227
1-imidazol-1-yldocosa-4,7,10,13,16,19-hexaen-1-one (PubChem CID 54386227) has the molecular formula C25H34N2O and a molecular weight of 378.56 g/mol. Its IUPAC name is 1-imidazol-1-yldocosa-4,7,10,13,16,19-hexaen-1-one.
| Compound Name | 1-imidazol-1-yldocosa-4,7,10,13,16,19-hexaen-1-one |
|---|---|
| PubChem CID | 54386227 |
| Molecular Formula | C25H34N2O |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 1-imidazol-1-yldocosa-4,7,10,13,16,19-hexaen-1-one |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)n1ccnc1 |
| InChI | InChI=1S/C25H34N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(28)27-23-22-26-24-27/h3-4,6-7,9-10,12-13,15-16,18-19,22-24H,2,5,8,11,14,17,20-21H2,1H3 |
| InChIKey | VDKXSBZTPOVQTQ-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|