C26H35NO4 — CID 54387812
butyl (4R)-4-hydroxy-2-[[2-(4-phenylbutyl)phenoxy]methyl]pyrrolidine-1-carboxylate (PubChem CID 54387812) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is butyl (4R)-4-hydroxy-2-[[2-(4-phenylbutyl)phenoxy]methyl]pyrrolidine-1-carboxylate.
| Compound Name | butyl (4R)-4-hydroxy-2-[[2-(4-phenylbutyl)phenoxy]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 54387812 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | butyl (4R)-4-hydroxy-2-[[2-(4-phenylbutyl)phenoxy]methyl]pyrrolidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1C[C@H](O)CC1COc1ccccc1CCCCc1ccccc1 |
| InChI | InChI=1S/C26H35NO4/c1-2-3-17-30-26(29)27-19-24(28)18-23(27)20-31-25-16-10-9-15-22(25)14-8-7-13-21-11-5-4-6-12-21/h4-6,9-12,15-16,23-24,28H,2-3,7-8,13-14,17-20H2,1H3/t23?,24-/m1/s1 |
| InChIKey | VEMRFYPUFIPIGC-XMMISQBUSA-N |
| XLogP | 5.00 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|