About 2-oxoethyl 3-[4-[3-oxo-3-(2-oxoethoxy)prop-1-enyl]phenyl]prop-2-enoate
2-oxoethyl 3-[4-[3-oxo-3-(2-oxoethoxy)prop-1-enyl]phenyl]prop-2-enoate (PubChem CID 54389925) has the molecular formula C16H14O6
and a molecular weight of 302.28 g/mol. Its IUPAC name is 2-oxoethyl 3-[4-[3-oxo-3-(2-oxoethoxy)prop-1-enyl]phenyl]prop-2-enoate.
Molecular Properties
| Compound Name | 2-oxoethyl 3-[4-[3-oxo-3-(2-oxoethoxy)prop-1-enyl]phenyl]prop-2-enoate |
| PubChem CID | 54389925 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 2-oxoethyl 3-[4-[3-oxo-3-(2-oxoethoxy)prop-1-enyl]phenyl]prop-2-enoate |
| SMILES | O=CCOC(=O)C=Cc1ccc(C=CC(=O)OCC=O)cc1 |
| InChI | InChI=1S/C16H14O6/c17-9-11-21-15(19)7-5-13-1-2-14(4-3-13)6-8-16(20)22-12-10-18/h1-10H,11-12H2 |
| InChIKey | VFXGXSQBYVBLLB-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-oxoethyl 3-[4-[3-oxo-3-(2-oxoethoxy)prop-1-enyl]phenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxoethyl 3-[4-[3-oxo-3-(2-oxoethoxy)prop-1-enyl]phenyl]prop-2-enoate?
The IUPAC name of 2-oxoethyl 3-[4-[3-oxo-3-(2-oxoethoxy)prop-1-enyl]phenyl]prop-2-enoate (CID 54389925) is 2-oxoethyl 3-[4-[3-oxo-3-(2-oxoethoxy)prop-1-enyl]phenyl]prop-2-enoate.
What is the SMILES notation for 2-oxoethyl 3-[4-[3-oxo-3-(2-oxoethoxy)prop-1-enyl]phenyl]prop-2-enoate?
The canonical SMILES for 2-oxoethyl 3-[4-[3-oxo-3-(2-oxoethoxy)prop-1-enyl]phenyl]prop-2-enoate is O=CCOC(=O)C=Cc1ccc(C=CC(=O)OCC=O)cc1.
What is the InChIKey of 2-oxoethyl 3-[4-[3-oxo-3-(2-oxoethoxy)prop-1-enyl]phenyl]prop-2-enoate?
The InChIKey is VFXGXSQBYVBLLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O6/c17-9-11-21-15(19)7-5-13-1-2-14(4-3-13)6-8-16(20)22-12-10-18/h1-10H,11-12H2.
What are the key properties of 2-oxoethyl 3-[4-[3-oxo-3-(2-oxoethoxy)prop-1-enyl]phenyl]prop-2-enoate?
2-oxoethyl 3-[4-[3-oxo-3-(2-oxoethoxy)prop-1-enyl]phenyl]prop-2-enoate has a molecular weight of 302.28 g/mol, XLogP of 1.20, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxoethyl 3-[4-[3-oxo-3-(2-oxoethoxy)prop-1-enyl]phenyl]prop-2-enoate is sourced from PubChem (CID 54389925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).