C7H12N2O4 — CID 54391730
1-(3-acetyl-2,2-dihydroxyimidazolidin-4-yl)ethanone (PubChem CID 54391730) has the molecular formula C7H12N2O4 and a molecular weight of 188.18 g/mol. Its IUPAC name is 1-(3-acetyl-2,2-dihydroxyimidazolidin-4-yl)ethanone.
| Compound Name | 1-(3-acetyl-2,2-dihydroxyimidazolidin-4-yl)ethanone |
|---|---|
| PubChem CID | 54391730 |
| Molecular Formula | C7H12N2O4 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 1-(3-acetyl-2,2-dihydroxyimidazolidin-4-yl)ethanone |
| SMILES | CC(=O)C1CNC(O)(O)N1C(C)=O |
| InChI | InChI=1S/C7H12N2O4/c1-4(10)6-3-8-7(12,13)9(6)5(2)11/h6,8,12-13H,3H2,1-2H3 |
| InChIKey | VHCGEUASZHUHHQ-UHFFFAOYSA-N |
| XLogP | -2.01 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|