C27H22N2O2 — CID 54393255
4-diazo-1,7-dinaphthalen-2-ylheptane-3,5-dione (PubChem CID 54393255) has the molecular formula C27H22N2O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is 4-diazo-1,7-dinaphthalen-2-ylheptane-3,5-dione.
| Compound Name | 4-diazo-1,7-dinaphthalen-2-ylheptane-3,5-dione |
|---|---|
| PubChem CID | 54393255 |
| Molecular Formula | C27H22N2O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 4-diazo-1,7-dinaphthalen-2-ylheptane-3,5-dione |
| SMILES | [N-]=[N+]=C(C(=O)CCc1ccc2ccccc2c1)C(=O)CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H22N2O2/c28-29-27(25(30)15-11-19-9-13-21-5-1-3-7-23(21)17-19)26(31)16-12-20-10-14-22-6-2-4-8-24(22)18-20/h1-10,13-14,17-18H,11-12,15-16H2 |
| InChIKey | VIDUDSRDEYYBDS-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 70.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|