C33H30Cl2N4O4 — CID 54393401
4-[3-[[2-[2,4-dichloro-N-methyl-3-[(2-methylquinolin-8-yl)oxymethyl]anilino]-2-oxoethyl]amino]-3-oxoprop-1-enyl]-N-prop-2-enylbenzamide (PubChem CID 54393401) has the molecular formula C33H30Cl2N4O4 and a molecular weight of 617.53 g/mol. Its IUPAC name is 4-[3-[[2-[2,4-dichloro-N-methyl-3-[(2-methylquinolin-8-yl)oxymethyl]anilino]-2-oxoethyl]amino]-3-oxoprop-1-enyl]-N-prop-2-enylbenzamide.
| Compound Name | 4-[3-[[2-[2,4-dichloro-N-methyl-3-[(2-methylquinolin-8-yl)oxymethyl]anilino]-2-oxoethyl]amino]-3-oxoprop-1-enyl]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 54393401 |
| Molecular Formula | C33H30Cl2N4O4 |
| Molecular Weight | 617.53 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | 4-[3-[[2-[2,4-dichloro-N-methyl-3-[(2-methylquinolin-8-yl)oxymethyl]anilino]-2-oxoethyl]amino]-3-oxoprop-1-enyl]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccc(C=CC(=O)NCC(=O)N(C)c2ccc(Cl)c(COc3cccc4ccc(C)nc34)c2Cl)cc1 |
| InChI | InChI=1S/C33H30Cl2N4O4/c1-4-18-36-33(42)24-13-9-22(10-14-24)11-17-29(40)37-19-30(41)39(3)27-16-15-26(34)25(31(27)35)20-43-28-7-5-6-23-12-8-21(2)38-32(23)28/h4-17H,1,18-20H2,2-3H3,(H,36,42)(H,37,40) |
| InChIKey | VIFYRRWODOGVMJ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.53 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|