C26H40N2O — CID 54393757
[4-(pentadeca-4,14-dienylamino)phenyl]-pyrrolidin-1-ylmethanone (PubChem CID 54393757) has the molecular formula C26H40N2O and a molecular weight of 396.62 g/mol. Its IUPAC name is [4-(pentadeca-4,14-dienylamino)phenyl]-pyrrolidin-1-ylmethanone.
| Compound Name | [4-(pentadeca-4,14-dienylamino)phenyl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 54393757 |
| Molecular Formula | C26H40N2O |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.31 |
| IUPAC Name | [4-(pentadeca-4,14-dienylamino)phenyl]-pyrrolidin-1-ylmethanone |
| SMILES | C=CCCCCCCCCC=CCCCNc1ccc(C(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C26H40N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-21-27-25-19-17-24(18-20-25)26(29)28-22-15-16-23-28/h2,11-12,17-20,27H,1,3-10,13-16,21-23H2 |
| InChIKey | VIMFJWPTLCZKET-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|