C31H34NO+ — CID 54396347
trimethyl-[[4-(3,3,3-triphenylpropoxy)phenyl]methyl]azanium (PubChem CID 54396347) has the molecular formula C31H34NO+ and a molecular weight of 436.62 g/mol. Its IUPAC name is trimethyl-[[4-(3,3,3-triphenylpropoxy)phenyl]methyl]azanium.
| Compound Name | trimethyl-[[4-(3,3,3-triphenylpropoxy)phenyl]methyl]azanium |
|---|---|
| PubChem CID | 54396347 |
| Molecular Formula | C31H34NO+ |
| Molecular Weight | 436.62 g/mol |
| Exact Mass | 436.26 |
| IUPAC Name | trimethyl-[[4-(3,3,3-triphenylpropoxy)phenyl]methyl]azanium |
| SMILES | C[N+](C)(C)Cc1ccc(OCCC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H34NO/c1-32(2,3)25-26-19-21-30(22-20-26)33-24-23-31(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h4-22H,23-25H2,1-3H3/q+1 |
| InChIKey | VKFVVHHDDFAACM-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.62 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|