C24H34N2O12 — CID 54396433
[2-oxo-2-[2-[[2-[4-[2-oxo-2-[2-(2-prop-2-enoyloxyacetyl)oxyethoxyamino]ethyl]cyclohexyl]acetyl]amino]oxyethoxy]ethyl] prop-2-enoate (PubChem CID 54396433) has the molecular formula C24H34N2O12 and a molecular weight of 542.54 g/mol. Its IUPAC name is [2-oxo-2-[2-[[2-[4-[2-oxo-2-[2-(2-prop-2-enoyloxyacetyl)oxyethoxyamino]ethyl]cyclohexyl]acetyl]amino]oxyethoxy]ethyl] prop-2-enoate.
| Compound Name | [2-oxo-2-[2-[[2-[4-[2-oxo-2-[2-(2-prop-2-enoyloxyacetyl)oxyethoxyamino]ethyl]cyclohexyl]acetyl]amino]oxyethoxy]ethyl] prop-2-enoate |
|---|---|
| PubChem CID | 54396433 |
| Molecular Formula | C24H34N2O12 |
| Molecular Weight | 542.54 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | [2-oxo-2-[2-[[2-[4-[2-oxo-2-[2-(2-prop-2-enoyloxyacetyl)oxyethoxyamino]ethyl]cyclohexyl]acetyl]amino]oxyethoxy]ethyl] prop-2-enoate |
| SMILES | C=CC(=O)OCC(=O)OCCONC(=O)CC1CCC(CC(=O)NOCCOC(=O)COC(=O)C=C)CC1 |
| InChI | InChI=1S/C24H34N2O12/c1-3-21(29)35-15-23(31)33-9-11-37-25-19(27)13-17-5-7-18(8-6-17)14-20(28)26-38-12-10-34-24(32)16-36-22(30)4-2/h3-4,17-18H,1-2,5-16H2,(H,25,27)(H,26,28) |
| InChIKey | VKHIYOYZLNEHOE-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 181.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.54 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|