C22H24N4O5 — CID 54396509
methyl 1,6-dimethyl-4-(3-nitrophenyl)-3-(3-oxocyclohexyl)-4,5-dihydropyrazolo[5,4-b]pyridine-5-carboxylate (PubChem CID 54396509) has the molecular formula C22H24N4O5 and a molecular weight of 424.46 g/mol. Its IUPAC name is methyl 1,6-dimethyl-4-(3-nitrophenyl)-3-(3-oxocyclohexyl)-4,5-dihydropyrazolo[5,4-b]pyridine-5-carboxylate.
| Compound Name | methyl 1,6-dimethyl-4-(3-nitrophenyl)-3-(3-oxocyclohexyl)-4,5-dihydropyrazolo[5,4-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 54396509 |
| Molecular Formula | C22H24N4O5 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | methyl 1,6-dimethyl-4-(3-nitrophenyl)-3-(3-oxocyclohexyl)-4,5-dihydropyrazolo[5,4-b]pyridine-5-carboxylate |
| SMILES | COC(=O)C1C(C)=Nc2c(c(C3CCCC(=O)C3)nn2C)C1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H24N4O5/c1-12-17(22(28)31-3)18(13-6-4-8-15(10-13)26(29)30)19-20(24-25(2)21(19)23-12)14-7-5-9-16(27)11-14/h4,6,8,10,14,17-18H,5,7,9,11H2,1-3H3 |
| InChIKey | VKIRCZJJRLTHDO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 116.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|