C13H11N5O2 — CID 54396894
2-phenoxy-N-(7H-purin-8-yl)acetamide (PubChem CID 54396894) has the molecular formula C13H11N5O2 and a molecular weight of 269.26 g/mol. Its IUPAC name is 2-phenoxy-N-(7H-purin-8-yl)acetamide.
| Compound Name | 2-phenoxy-N-(7H-purin-8-yl)acetamide |
|---|---|
| PubChem CID | 54396894 |
| Molecular Formula | C13H11N5O2 |
| Molecular Weight | 269.26 g/mol |
| Exact Mass | 269.09 |
| IUPAC Name | 2-phenoxy-N-(7H-purin-8-yl)acetamide |
| SMILES | O=C(COc1ccccc1)Nc1nc2ncncc2[nH]1 |
| InChI | InChI=1S/C13H11N5O2/c19-11(7-20-9-4-2-1-3-5-9)17-13-16-10-6-14-8-15-12(10)18-13/h1-6,8H,7H2,(H2,14,15,16,17,18,19) |
| InChIKey | VKPXICFWJMRPJQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.26 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |