C23H25ClN12O3 — CID 11599273
3,5-diamino-6-chloro-N-[N'-[4-[4-[2-oxo-2-(7H-purin-8-ylamino)ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 11599273) has the molecular formula C23H25ClN12O3 and a molecular weight of 552.99 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-oxo-2-(7H-purin-8-ylamino)ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-oxo-2-(7H-purin-8-ylamino)ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 11599273 |
| Molecular Formula | C23H25ClN12O3 |
| Molecular Weight | 552.99 g/mol |
| Exact Mass | 552.19 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[2-oxo-2-(7H-purin-8-ylamino)ethoxy]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | N/C(=N\CCCCc1ccc(OCC(=O)Nc2nc3ncncc3[nH]2)cc1)NC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C23H25ClN12O3/c24-17-19(26)34-18(25)16(33-17)21(38)36-22(27)29-8-2-1-3-12-4-6-13(7-5-12)39-10-15(37)32-23-31-14-9-28-11-30-20(14)35-23/h4-7,9,11H,1-3,8,10H2,(H4,25,26,34)(H3,27,29,36,38)(H2,28,30,31,32,35,37) |
| InChIKey | DYCKYUDPRWSITJ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 238.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.99 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|