C28H33N3O4 — CID 54399309
N-[(2R)-3-amino-2-hydroxypropyl]-4-methyl-2-(naphthalen-2-ylmethyl)-3-oxo-4-[(2-phenylacetyl)amino]pentanamide (PubChem CID 54399309) has the molecular formula C28H33N3O4 and a molecular weight of 475.59 g/mol. Its IUPAC name is N-[(2R)-3-amino-2-hydroxypropyl]-4-methyl-2-(naphthalen-2-ylmethyl)-3-oxo-4-[(2-phenylacetyl)amino]pentanamide.
| Compound Name | N-[(2R)-3-amino-2-hydroxypropyl]-4-methyl-2-(naphthalen-2-ylmethyl)-3-oxo-4-[(2-phenylacetyl)amino]pentanamide |
|---|---|
| PubChem CID | 54399309 |
| Molecular Formula | C28H33N3O4 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.25 |
| IUPAC Name | N-[(2R)-3-amino-2-hydroxypropyl]-4-methyl-2-(naphthalen-2-ylmethyl)-3-oxo-4-[(2-phenylacetyl)amino]pentanamide |
| SMILES | CC(C)(NC(=O)Cc1ccccc1)C(=O)C(Cc1ccc2ccccc2c1)C(=O)NC[C@H](O)CN |
| InChI | InChI=1S/C28H33N3O4/c1-28(2,31-25(33)16-19-8-4-3-5-9-19)26(34)24(27(35)30-18-23(32)17-29)15-20-12-13-21-10-6-7-11-22(21)14-20/h3-14,23-24,32H,15-18,29H2,1-2H3,(H,30,35)(H,31,33)/t23-,24?/m1/s1 |
| InChIKey | VMGNMTPHJRJRSZ-MIHMCVIASA-N |
| XLogP | 2.14 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|