C25H28O3 — CID 54399846
3-ethyl-7-(2-hydroxynaphthalen-1-yl)-7-phenylheptanoic acid (PubChem CID 54399846) has the molecular formula C25H28O3 and a molecular weight of 376.50 g/mol. Its IUPAC name is 3-ethyl-7-(2-hydroxynaphthalen-1-yl)-7-phenylheptanoic acid.
| Compound Name | 3-ethyl-7-(2-hydroxynaphthalen-1-yl)-7-phenylheptanoic acid |
|---|---|
| PubChem CID | 54399846 |
| Molecular Formula | C25H28O3 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.20 |
| IUPAC Name | 3-ethyl-7-(2-hydroxynaphthalen-1-yl)-7-phenylheptanoic acid |
| SMILES | CCC(CCCC(c1ccccc1)c1c(O)ccc2ccccc12)CC(=O)O |
| InChI | InChI=1S/C25H28O3/c1-2-18(17-24(27)28)9-8-14-22(19-10-4-3-5-11-19)25-21-13-7-6-12-20(21)15-16-23(25)26/h3-7,10-13,15-16,18,22,26H,2,8-9,14,17H2,1H3,(H,27,28) |
| InChIKey | VMPXCABDSSAIMS-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |