C13H22O5 — CID 54401352
ethyl 5-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-enoate (PubChem CID 54401352) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is ethyl 5-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-enoate.
| Compound Name | ethyl 5-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-enoate |
|---|---|
| PubChem CID | 54401352 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | ethyl 5-[5-(hydroxymethyl)-2,2-dimethyl-1,3-dioxolan-4-yl]pent-4-enoate |
| SMILES | CCOC(=O)CCC=CC1OC(C)(C)OC1CO |
| InChI | InChI=1S/C13H22O5/c1-4-16-12(15)8-6-5-7-10-11(9-14)18-13(2,3)17-10/h5,7,10-11,14H,4,6,8-9H2,1-3H3 |
| InChIKey | VNQUBYXCAKRZLY-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|