C11H18O4 — CID 101166228
(Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid (PubChem CID 101166228) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid.
| Compound Name | (Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid |
|---|---|
| PubChem CID | 101166228 |
| Molecular Formula | C11H18O4 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid |
| SMILES | CC1(C)OCC(C/C=C\CCC(=O)O)O1 |
| InChI | InChI=1S/C11H18O4/c1-11(2)14-8-9(15-11)6-4-3-5-7-10(12)13/h3-4,9H,5-8H2,1-2H3,(H,12,13)/b4-3- |
| InChIKey | DQQOKCPSQZARGX-ARJAWSKDSA-N |
| XLogP | 1.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|