(Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid

C11H18O4 — CID 101166228

IUPAC(Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid
SMILESCC1(C)OCC(C/C=C\CCC(=O)O)O1
InChIInChI=1S/C11H18O4/c1-11(2)14-8-9(15-11)6-4-3-5-7-10(12)13/h3-4,9H,5-8H2,1-2H3,(H,12,13)/b4-3-
InChIKeyDQQOKCPSQZARGX-ARJAWSKDSA-N
MW214.26 g/mol
LogP1.95
Rot. Bonds5

About (Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid

(Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid (PubChem CID 101166228) has the molecular formula C11H18O4 and a molecular weight of 214.26 g/mol. Its IUPAC name is (Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid.

Molecular Properties

Compound Name(Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid
PubChem CID101166228
Molecular FormulaC11H18O4
Molecular Weight214.26 g/mol
Exact Mass214.12
IUPAC Name(Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid
SMILESCC1(C)OCC(C/C=C\CCC(=O)O)O1
InChIInChI=1S/C11H18O4/c1-11(2)14-8-9(15-11)6-4-3-5-7-10(12)13/h3-4,9H,5-8H2,1-2H3,(H,12,13)/b4-3-
InChIKeyDQQOKCPSQZARGX-ARJAWSKDSA-N
XLogP1.95
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500214.26
LogP ≤ 51.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid?
The IUPAC name of (Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid (CID 101166228) is (Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid.
What is the SMILES notation for (Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid?
The canonical SMILES for (Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid is CC1(C)OCC(C/C=C\CCC(=O)O)O1.
What is the InChIKey of (Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid?
The InChIKey is DQQOKCPSQZARGX-ARJAWSKDSA-N. The full InChI is InChI=1S/C11H18O4/c1-11(2)14-8-9(15-11)6-4-3-5-7-10(12)13/h3-4,9H,5-8H2,1-2H3,(H,12,13)/b4-3-.
What are the key properties of (Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid?
(Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid has a molecular weight of 214.26 g/mol, XLogP of 1.95, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-6-(2,2-dimethyl-1,3-dioxolan-4-yl)hex-4-enoic acid is sourced from PubChem (CID 101166228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).