C10H14O6 — CID 134892527
methyl (E,6R)-6-hydroxy-6-[(4S)-2-oxo-1,3-dioxolan-4-yl]hex-4-enoate (PubChem CID 134892527) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is methyl (E,6R)-6-hydroxy-6-[(4S)-2-oxo-1,3-dioxolan-4-yl]hex-4-enoate.
| Compound Name | methyl (E,6R)-6-hydroxy-6-[(4S)-2-oxo-1,3-dioxolan-4-yl]hex-4-enoate |
|---|---|
| PubChem CID | 134892527 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | methyl (E,6R)-6-hydroxy-6-[(4S)-2-oxo-1,3-dioxolan-4-yl]hex-4-enoate |
| SMILES | COC(=O)CC/C=C/[C@@H](O)[C@@H]1COC(=O)O1 |
| InChI | InChI=1S/C10H14O6/c1-14-9(12)5-3-2-4-7(11)8-6-15-10(13)16-8/h2,4,7-8,11H,3,5-6H2,1H3/b4-2+/t7-,8+/m1/s1 |
| InChIKey | BNCJXJYKUYIRDF-KHMYBQILSA-N |
| XLogP | 0.39 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|