C9H12O4S — CID 101166230
(Z)-6-(2-sulfanylidene-1,3-dioxolan-4-yl)hex-4-enoic acid (PubChem CID 101166230) has the molecular formula C9H12O4S and a molecular weight of 216.26 g/mol. Its IUPAC name is (Z)-6-(2-sulfanylidene-1,3-dioxolan-4-yl)hex-4-enoic acid.
| Compound Name | (Z)-6-(2-sulfanylidene-1,3-dioxolan-4-yl)hex-4-enoic acid |
|---|---|
| PubChem CID | 101166230 |
| Molecular Formula | C9H12O4S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.05 |
| IUPAC Name | (Z)-6-(2-sulfanylidene-1,3-dioxolan-4-yl)hex-4-enoic acid |
| SMILES | O=C(O)CC/C=C\CC1COC(=S)O1 |
| InChI | InChI=1S/C9H12O4S/c10-8(11)5-3-1-2-4-7-6-12-9(14)13-7/h1-2,7H,3-6H2,(H,10,11)/b2-1- |
| InChIKey | KSWMMCFHYBTSKD-UPHRSURJSA-N |
| XLogP | 1.50 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|