C10H14F3NO2 — CID 54403503
2,2,2-trifluoro-N-[2-(4-oxocyclohexyl)ethyl]acetamide (PubChem CID 54403503) has the molecular formula C10H14F3NO2 and a molecular weight of 237.22 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(4-oxocyclohexyl)ethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-(4-oxocyclohexyl)ethyl]acetamide |
|---|---|
| PubChem CID | 54403503 |
| Molecular Formula | C10H14F3NO2 |
| Molecular Weight | 237.22 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(4-oxocyclohexyl)ethyl]acetamide |
| SMILES | O=C1CCC(CCNC(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H14F3NO2/c11-10(12,13)9(16)14-6-5-7-1-3-8(15)4-2-7/h7H,1-6H2,(H,14,16) |
| InChIKey | VPBSAJINARAMSA-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |