C29H48ClN3O5 — CID 54404300
tert-butyl N-[(2R)-6-amino-1-(dipentylamino)-1-oxohexan-2-yl]-N-[(2-chlorophenyl)methoxycarbonyl]carbamate (PubChem CID 54404300) has the molecular formula C29H48ClN3O5 and a molecular weight of 554.17 g/mol. Its IUPAC name is tert-butyl N-[(2R)-6-amino-1-(dipentylamino)-1-oxohexan-2-yl]-N-[(2-chlorophenyl)methoxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[(2R)-6-amino-1-(dipentylamino)-1-oxohexan-2-yl]-N-[(2-chlorophenyl)methoxycarbonyl]carbamate |
|---|---|
| PubChem CID | 54404300 |
| Molecular Formula | C29H48ClN3O5 |
| Molecular Weight | 554.17 g/mol |
| Exact Mass | 553.33 |
| IUPAC Name | tert-butyl N-[(2R)-6-amino-1-(dipentylamino)-1-oxohexan-2-yl]-N-[(2-chlorophenyl)methoxycarbonyl]carbamate |
| SMILES | CCCCCN(CCCCC)C(=O)[C@@H](CCCCN)N(C(=O)OCc1ccccc1Cl)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C29H48ClN3O5/c1-6-8-14-20-32(21-15-9-7-2)26(34)25(18-12-13-19-31)33(28(36)38-29(3,4)5)27(35)37-22-23-16-10-11-17-24(23)30/h10-11,16-17,25H,6-9,12-15,18-22,31H2,1-5H3/t25-/m1/s1 |
| InChIKey | VPOPVTFBJOYSLT-RUZDIDTESA-N |
| XLogP | 6.92 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.17 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|