C23H21N5S — CID 54406307
N,N-diphenyl-4-(1-phenyltetrazol-5-yl)butanethioamide (PubChem CID 54406307) has the molecular formula C23H21N5S and a molecular weight of 399.52 g/mol. Its IUPAC name is N,N-diphenyl-4-(1-phenyltetrazol-5-yl)butanethioamide.
| Compound Name | N,N-diphenyl-4-(1-phenyltetrazol-5-yl)butanethioamide |
|---|---|
| PubChem CID | 54406307 |
| Molecular Formula | C23H21N5S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | N,N-diphenyl-4-(1-phenyltetrazol-5-yl)butanethioamide |
| SMILES | S=C(CCCc1nnnn1-c1ccccc1)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H21N5S/c29-23(27(19-11-4-1-5-12-19)20-13-6-2-7-14-20)18-10-17-22-24-25-26-28(22)21-15-8-3-9-16-21/h1-9,11-16H,10,17-18H2 |
| InChIKey | VQXWEKVVNLKYCD-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|