C24H35N5O — CID 21295615
N,N-dicyclohexyl-5-(1-phenyltetrazol-5-yl)pentanamide (PubChem CID 21295615) has the molecular formula C24H35N5O and a molecular weight of 409.58 g/mol. Its IUPAC name is N,N-dicyclohexyl-5-(1-phenyltetrazol-5-yl)pentanamide.
| Compound Name | N,N-dicyclohexyl-5-(1-phenyltetrazol-5-yl)pentanamide |
|---|---|
| PubChem CID | 21295615 |
| Molecular Formula | C24H35N5O |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.28 |
| IUPAC Name | N,N-dicyclohexyl-5-(1-phenyltetrazol-5-yl)pentanamide |
| SMILES | O=C(CCCCc1nnnn1-c1ccccc1)N(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C24H35N5O/c30-24(28(20-12-4-1-5-13-20)21-14-6-2-7-15-21)19-11-10-18-23-25-26-27-29(23)22-16-8-3-9-17-22/h3,8-9,16-17,20-21H,1-2,4-7,10-15,18-19H2 |
| InChIKey | UVHMTVDNVDNXHA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|