C9H8ClNO3S — CID 54406664
6-(2-chloroethylsulfinyl)-3H-1,3-benzoxazol-2-one (PubChem CID 54406664) has the molecular formula C9H8ClNO3S and a molecular weight of 245.69 g/mol. Its IUPAC name is 6-(2-chloroethylsulfinyl)-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-(2-chloroethylsulfinyl)-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 54406664 |
| Molecular Formula | C9H8ClNO3S |
| Molecular Weight | 245.69 g/mol |
| Exact Mass | 244.99 |
| IUPAC Name | 6-(2-chloroethylsulfinyl)-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(S(=O)CCCl)cc2o1 |
| InChI | InChI=1S/C9H8ClNO3S/c10-3-4-15(13)6-1-2-7-8(5-6)14-9(12)11-7/h1-2,5H,3-4H2,(H,11,12) |
| InChIKey | VREAWHXFCQZELL-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.69 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|