C12H16N4O2 — CID 54408872
4-[1-(2,5-dimethyl-3-oxo-1H-pyrazol-4-yl)ethylidene]-2,5-dimethylpyrazol-3-one (PubChem CID 54408872) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 4-[1-(2,5-dimethyl-3-oxo-1H-pyrazol-4-yl)ethylidene]-2,5-dimethylpyrazol-3-one.
| Compound Name | 4-[1-(2,5-dimethyl-3-oxo-1H-pyrazol-4-yl)ethylidene]-2,5-dimethylpyrazol-3-one |
|---|---|
| PubChem CID | 54408872 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4-[1-(2,5-dimethyl-3-oxo-1H-pyrazol-4-yl)ethylidene]-2,5-dimethylpyrazol-3-one |
| SMILES | CC1=NN(C)C(=O)C1=C(C)c1c(C)[nH]n(C)c1=O |
| InChI | InChI=1S/C12H16N4O2/c1-6(9-7(2)13-15(4)11(9)17)10-8(3)14-16(5)12(10)18/h13H,1-5H3 |
| InChIKey | XLQWUKBHMBJVPH-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 70.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|