C20H25NO — CID 54410683
4-(diethylamino)-1,2-diphenylbut-2-en-1-ol (PubChem CID 54410683) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 4-(diethylamino)-1,2-diphenylbut-2-en-1-ol.
| Compound Name | 4-(diethylamino)-1,2-diphenylbut-2-en-1-ol |
|---|---|
| PubChem CID | 54410683 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 4-(diethylamino)-1,2-diphenylbut-2-en-1-ol |
| SMILES | CCN(CC)CC=C(c1ccccc1)C(O)c1ccccc1 |
| InChI | InChI=1S/C20H25NO/c1-3-21(4-2)16-15-19(17-11-7-5-8-12-17)20(22)18-13-9-6-10-14-18/h5-15,20,22H,3-4,16H2,1-2H3 |
| InChIKey | VTXBIYWZTGKDDY-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |