C12H27N3 — CID 54412174
1,2,3-trimethyl-1,2,3-triazacyclododecane (PubChem CID 54412174) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is 1,2,3-trimethyl-1,2,3-triazacyclododecane.
| Compound Name | 1,2,3-trimethyl-1,2,3-triazacyclododecane |
|---|---|
| PubChem CID | 54412174 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | 1,2,3-trimethyl-1,2,3-triazacyclododecane |
| SMILES | CN1CCCCCCCCCN(C)N1C |
| InChI | InChI=1S/C12H27N3/c1-13-11-9-7-5-4-6-8-10-12-14(2)15(13)3/h4-12H2,1-3H3 |
| InChIKey | VUXBPNMRSUBXKZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |