C21H27ClO3 — CID 54413932
4-[3-(4-chlorophenoxy)propoxy]-3,5-di(propan-2-yl)phenol (PubChem CID 54413932) has the molecular formula C21H27ClO3 and a molecular weight of 362.90 g/mol. Its IUPAC name is 4-[3-(4-chlorophenoxy)propoxy]-3,5-di(propan-2-yl)phenol.
| Compound Name | 4-[3-(4-chlorophenoxy)propoxy]-3,5-di(propan-2-yl)phenol |
|---|---|
| PubChem CID | 54413932 |
| Molecular Formula | C21H27ClO3 |
| Molecular Weight | 362.90 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 4-[3-(4-chlorophenoxy)propoxy]-3,5-di(propan-2-yl)phenol |
| SMILES | CC(C)c1cc(O)cc(C(C)C)c1OCCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H27ClO3/c1-14(2)19-12-17(23)13-20(15(3)4)21(19)25-11-5-10-24-18-8-6-16(22)7-9-18/h6-9,12-15,23H,5,10-11H2,1-4H3 |
| InChIKey | VWAUGXZVMKQWEZ-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.90 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|