C21H26O3 — CID 54416249
(8'S,13'S,14'S)-2'-ethylspiro[1,3-dioxolane-2,3'-2,6,7,8,13,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene]-17'-one (PubChem CID 54416249) has the molecular formula C21H26O3 and a molecular weight of 326.44 g/mol. Its IUPAC name is (8'S,13'S,14'S)-2'-ethylspiro[1,3-dioxolane-2,3'-2,6,7,8,13,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene]-17'-one.
| Compound Name | (8'S,13'S,14'S)-2'-ethylspiro[1,3-dioxolane-2,3'-2,6,7,8,13,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
|---|---|
| PubChem CID | 54416249 |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (8'S,13'S,14'S)-2'-ethylspiro[1,3-dioxolane-2,3'-2,6,7,8,13,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene]-17'-one |
| SMILES | CCC1CC2=C3C=C[C@@H]4C(=O)CC[C@H]4[C@@H]3CCC2=CC12OCCO2 |
| InChI | InChI=1S/C21H26O3/c1-2-14-11-19-13(12-21(14)23-9-10-24-21)3-4-15-16-7-8-20(22)18(16)6-5-17(15)19/h5-6,12,14-16,18H,2-4,7-11H2,1H3/t14?,15-,16-,18-/m0/s1 |
| InChIKey | VXQHDTMDIKIRIB-OVQIEAOZSA-N |
| XLogP | 3.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |