C19H24O6 — CID 54417005
[2,2-dimethyl-1-(3-oxobutanoyloxy)-1-phenylpropyl] 3-oxobutanoate (PubChem CID 54417005) has the molecular formula C19H24O6 and a molecular weight of 348.40 g/mol. Its IUPAC name is [2,2-dimethyl-1-(3-oxobutanoyloxy)-1-phenylpropyl] 3-oxobutanoate.
| Compound Name | [2,2-dimethyl-1-(3-oxobutanoyloxy)-1-phenylpropyl] 3-oxobutanoate |
|---|---|
| PubChem CID | 54417005 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | [2,2-dimethyl-1-(3-oxobutanoyloxy)-1-phenylpropyl] 3-oxobutanoate |
| SMILES | CC(=O)CC(=O)OC(OC(=O)CC(C)=O)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C19H24O6/c1-13(20)11-16(22)24-19(18(3,4)5,15-9-7-6-8-10-15)25-17(23)12-14(2)21/h6-10H,11-12H2,1-5H3 |
| InChIKey | VYDWARSRTUHABM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|