C20H16N2O2 — CID 54419533
1,4-bis[nitroso(phenyl)methyl]benzene (PubChem CID 54419533) has the molecular formula C20H16N2O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1,4-bis[nitroso(phenyl)methyl]benzene.
| Compound Name | 1,4-bis[nitroso(phenyl)methyl]benzene |
|---|---|
| PubChem CID | 54419533 |
| Molecular Formula | C20H16N2O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 1,4-bis[nitroso(phenyl)methyl]benzene |
| SMILES | O=NC(c1ccccc1)c1ccc(C(N=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H16N2O2/c23-21-19(15-7-3-1-4-8-15)17-11-13-18(14-12-17)20(22-24)16-9-5-2-6-10-16/h1-14,19-20H |
| InChIKey | VZUPXRSQZAUMRI-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 58.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |